506-24-1 stearolic acid
Naam product |
stearolic acid |
Engelse naam |
stearolic acid; Octadec-9-ynoic acid |
MF |
C18H32O2 |
Molecuulgewicht |
280.4455 |
InChI |
InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
CAS-nummer |
506-24-1 |
EINECS |
208-030-8 |
Moleculaire Structuur |
|
Dichtheid |
0.923g/cm3 |
Kookpunt |
405.2°C at 760 mmHg |
Brekingsindex |
1.471 |
Vlampunt |
196.3°C |
Dampdruk |
1.07E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|