ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
| Naam product |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
| Engelse naam |
Methyl 2-nitro-3,4,5-trimethoxybenzoate; 2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
| MF |
C11H13NO7 |
| Molecuulgewicht |
271.2234 |
| InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
| CAS-nummer |
5081-42-5 |
| EINECS |
225-794-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.284g/cm3 |
| Kookpunt |
420°C at 760 mmHg |
| Brekingsindex |
1.523 |
| Vlampunt |
188.9°C |
| Dampdruk |
2.9E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
