50998-17-9 6-bromoquinoxaline
Naam product |
6-bromoquinoxaline |
Engelse naam |
6-bromoquinoxaline; Quinoxaline, 6-bromo- |
MF |
C8H5BrN2 |
Molecuulgewicht |
209.0427 |
InChI |
InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H |
CAS-nummer |
50998-17-9 |
Moleculaire Structuur |
|
Dichtheid |
1.656g/cm3 |
Smeltpunt |
53℃ |
Kookpunt |
300.2°C at 760 mmHg |
Brekingsindex |
1.685 |
Vlampunt |
135.4°C |
Dampdruk |
0.00203mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|