ChemNet > CAS > 51067-38-0 4-Phenoxyphenyl boronic acid
51067-38-0 4-Phenoxyphenyl boronic acid
Naam product |
4-Phenoxyphenyl boronic acid |
Engelse naam |
4-Phenoxyphenyl boronic acid; 4-Phenoxybenzene boronic acid;
|
MF |
C12H11BO3 |
Molecuulgewicht |
214.0249 |
InChI |
InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
CAS-nummer |
51067-38-0 |
Moleculaire Structuur |
|
Dichtheid |
1.23g/cm3 |
Smeltpunt |
141-145℃ |
Kookpunt |
377°C at 760 mmHg |
Brekingsindex |
1.605 |
Vlampunt |
181.8°C |
Dampdruk |
2.36E-06mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|