ChemNet > CAS > 5112-95-8 Bis(diphenylphosphino)acetylene
5112-95-8 Bis(diphenylphosphino)acetylene
Naam product |
Bis(diphenylphosphino)acetylene |
Engelse naam |
Bis(diphenylphosphino)acetylene;Ethynylenebis(diphenylphosphine); ethyne-1,2-diylbis(diphenylphosphane) |
MF |
C26H20P2 |
Molecuulgewicht |
394.3845 |
InChI |
InChI=1/C26H20P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H |
CAS-nummer |
5112-95-8 |
EINECS |
225-842-8 |
Moleculaire Structuur |
|
Smeltpunt |
84-88℃ |
Kookpunt |
529.6°C at 760 mmHg |
Vlampunt |
291.4°C |
Dampdruk |
9.04E-11mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|