ChemNet > CAS > 51449-81-1 5-(2-Methoxyphenyl)-1H-tetrazole
51449-81-1 5-(2-Methoxyphenyl)-1H-tetrazole
Naam product |
5-(2-Methoxyphenyl)-1H-tetrazole |
Engelse naam |
5-(2-Methoxyphenyl)-1H-tetrazole;5-(2-methoxyphenyl)-2H-tetrazole |
MF |
C8H8N4O |
Molecuulgewicht |
176.1753 |
InChI |
InChI=1/C8H8N4O/c1-13-7-5-3-2-4-6(7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
CAS-nummer |
51449-81-1 |
Moleculaire Structuur |
|
Dichtheid |
1.288g/cm3 |
Kookpunt |
378.2°C at 760 mmHg |
Brekingsindex |
1.591 |
Vlampunt |
137.6°C |
Dampdruk |
6.41E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|