ChemNet > CAS > 51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
Naam product |
Benzene, 1,4-diiodo-2,5-dimethoxy- |
Engelse naam |
Benzene, 1,4-diiodo-2,5-dimethoxy-; 1,4-Diiodo-2,5-dimethoxybenzene |
MF |
C8H8I2O2 |
Molecuulgewicht |
389.9569 |
InChI |
InChI=1/C8H8I2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
CAS-nummer |
51560-21-5 |
Moleculaire Structuur |
|
Dichtheid |
2.147g/cm3 |
Smeltpunt |
171℃ |
Kookpunt |
382.9°C at 760 mmHg |
Brekingsindex |
1.64 |
Vlampunt |
185.4°C |
Dampdruk |
1.01E-05mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|