ChemNet > CAS > 51605-32-4 Ethyl 4-methyl-5-imidazolecarboxylate
51605-32-4 Ethyl 4-methyl-5-imidazolecarboxylate
Naam product |
Ethyl 4-methyl-5-imidazolecarboxylate |
Engelse naam |
Ethyl 4-methyl-5-imidazolecarboxylate; ethyl 5-methyl-1H-imidazole-4-carboxylate; ethyl 4-methyl-1H-imidazole-5-carboxylate |
MF |
C7H10N2O2 |
Molecuulgewicht |
154.1665 |
InChI |
InChI=1/C7H10N2O2/c1-3-11-7(10)6-5(2)8-4-9-6/h4H,3H2,1-2H3,(H,8,9) |
CAS-nummer |
51605-32-4 |
EINECS |
257-315-3 |
Moleculaire Structuur |
|
Dichtheid |
1.171g/cm3 |
Smeltpunt |
204-206℃ |
Kookpunt |
323.663°C at 760 mmHg |
Brekingsindex |
1.52 |
Vlampunt |
149.546°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|