ChemNet > CAS > 5182-44-5 3-Chlorophenethylalcohol
5182-44-5 3-Chlorophenethylalcohol
Naam product |
3-Chlorophenethylalcohol |
Engelse naam |
3-Chlorophenethylalcohol; 3-Chlorophenethyl alcohol; 2-(3-Chlorophenyl)ethanol |
MF |
C8H9ClO |
Molecuulgewicht |
156.6095 |
InChI |
InChI=1/C8H9ClO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
CAS-nummer |
5182-44-5 |
EINECS |
225-964-1 |
Moleculaire Structuur |
|
Dichtheid |
1.189g/cm3 |
Kookpunt |
257.2°C at 760 mmHg |
Brekingsindex |
1.554 |
Vlampunt |
101.1°C |
Dampdruk |
0.00756mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|