ChemNet > CAS > 519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
Naam product |
2-Carboxy-3,4-dimethoxybenzaldehyde |
Engelse naam |
2-Carboxy-3,4-dimethoxybenzaldehyde; 5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid; 6-formyl-2,3-dimethoxybenzoic acid |
MF |
C10H10O5 |
Molecuulgewicht |
210.1834 |
InChI |
InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
CAS-nummer |
519-05-1 |
EINECS |
208-261-4 |
Moleculaire Structuur |
|
Dichtheid |
1.3g/cm3 |
Kookpunt |
386.3°C at 760 mmHg |
Brekingsindex |
1.573 |
Vlampunt |
155.1°C |
Dampdruk |
1.17E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|