The physical and chemical property of 52080-58-7 is provided by ChemNet.com
Chemical CAS Database with Global Chemical Suppliers - ChemNet


   ChemNet > CAS > 52080-58-7 methyl violet B base

52080-58-7 methyl violet B base

Naam product methyl violet B base
Engelse naam methyl violet B base; C.I. Solvent Violet 8; Methyl violet 2B base (C.I. 42535:1); Solvent Violet 8
MF C24H27N3
Molecuulgewicht 357.5
InChI InChI=1/C24H27N3/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5/h6-17H,1-5H3
CAS-nummer 52080-58-7
Moleculaire Structuur 52080-58-7 methyl violet B base
Gevaarsymbolen
Risico-codes
Veiligheid Omschrijving