ChemNet > CAS > 52178-50-4 methyl 3-formylbenzoate
52178-50-4 methyl 3-formylbenzoate
Naam product |
methyl 3-formylbenzoate |
Engelse naam |
methyl 3-formylbenzoate; Methyl benzaldehyde-4-carboxylate |
MF |
C9H8O3 |
Molecuulgewicht |
164.158 |
InChI |
InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
CAS-nummer |
52178-50-4 |
Moleculaire Structuur |
|
Dichtheid |
1.181g/cm3 |
Smeltpunt |
48-55℃ |
Kookpunt |
272.8°C at 760 mmHg |
Brekingsindex |
1.557 |
Vlampunt |
118.2°C |
Dampdruk |
0.00596mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|