ChemNet > CAS > 5266-85-3 2-Methyl-6-isopropylaniline
5266-85-3 2-Methyl-6-isopropylaniline
| Naam product |
2-Methyl-6-isopropylaniline |
| Engelse naam |
2-Methyl-6-isopropylaniline; 2-Methyl-6-(1-methylethyl)benzenamine; 2-Isopropyl-6-methylaniline; 6-isopropyl-o-toluidine; 2-methyl-6-(propan-2-yl)aniline |
| MF |
C10H15N |
| Molecuulgewicht |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
| CAS-nummer |
5266-85-3 |
| EINECS |
226-083-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.944g/cm3 |
| Kookpunt |
236.2°C at 760 mmHg |
| Brekingsindex |
1.538 |
| Vlampunt |
97.8°C |
| Dampdruk |
0.048mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
