ChemNet > CAS > 52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
| Naam product |
4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline |
| Engelse naam |
4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline; |
| MF |
C11H13N3 |
| Molecuulgewicht |
187.241 |
| InChI |
InChI=1/C11H13N3/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,12H2,1-2H3 |
| CAS-nummer |
52708-32-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.14g/cm3 |
| Smeltpunt |
78℃ |
| Kookpunt |
338.2°C at 760 mmHg |
| Brekingsindex |
1.611 |
| Vlampunt |
158.3°C |
| Dampdruk |
9.98E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|