ChemNet > CAS > 53065-47-7 4-isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol
53065-47-7 4-isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol
| Naam product |
4-isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol |
| Synoniemen |
4-(1-methylethyl)-5-thioxo-1,2,4-triazolidine-3-on |
| Engelse naam |
4-isopropyl-5-mercapto-4H-1,2,4-triazol-3-ol;4-(1-methylethyl)-5-thioxo-1,2,4-triazolidin-3-one |
| MF |
C5H9N3OS |
| Molecuulgewicht |
159.2095 |
| InChI |
InChI=1/C5H9N3OS/c1-3(2)8-4(9)6-7-5(8)10/h3H,1-2H3,(H,6,9)(H,7,10) |
| CAS-nummer |
53065-47-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.34g/cm3 |
| Smeltpunt |
167℃ |
| Kookpunt |
347.7°C at 760 mmHg |
| Brekingsindex |
1.621 |
| Vlampunt |
164.1°C |
| Dampdruk |
2.64E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|