ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
Naam product |
3-Ethoxy-2-cyclohexen-1-one |
Engelse naam |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
MF |
C8H12O2 |
Molecuulgewicht |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
CAS-nummer |
5323-87-5 |
EINECS |
226-190-7 |
Moleculaire Structuur |
|
Dichtheid |
1g/cm3 |
Kookpunt |
250.1°C at 760 mmHg |
Brekingsindex |
1.467 |
Vlampunt |
107.2°C |
Dampdruk |
0.022mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|