ChemNet > CAS > 53233-89-9 5-Chloro-2,3-dihydroxypyridine
53233-89-9 5-Chloro-2,3-dihydroxypyridine
| Naam product |
5-Chloro-2,3-dihydroxypyridine |
| Engelse naam |
5-Chloro-2,3-dihydroxypyridine; 5-Chloropyridine-2,3-diol; 5-chloro-3-hydroxypyridin-2(1H)-one |
| MF |
C5H4ClNO2 |
| Molecuulgewicht |
145.5438 |
| InChI |
InChI=1/C5H4ClNO2/c6-3-1-4(8)5(9)7-2-3/h1-2,8H,(H,7,9) |
| CAS-nummer |
53233-89-9 |
| EINECS |
258-441-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.56g/cm3 |
| Smeltpunt |
295℃ |
| Kookpunt |
297.6°C at 760 mmHg |
| Brekingsindex |
1.617 |
| Vlampunt |
133.8°C |
| Dampdruk |
0.000135mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
