5328-01-8 1-Ethoxynaphthalene
Naam product |
1-Ethoxynaphthalene |
Engelse naam |
1-Ethoxynaphthalene;Ethyl 1-naphthyl ether; Ethyl alpha-naphthyl ether; ; alpha-Ethoxynaphthalene; Naphthalene, 1-ethoxy-; 1-Naphthol ethyl ether; Naphtholethylether |
MF |
C12H12O |
Molecuulgewicht |
172.2231 |
InChI |
InChI=1/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
CAS-nummer |
5328-01-8 |
EINECS |
226-213-0 |
Moleculaire Structuur |
|
Dichtheid |
1.049g/cm3 |
Kookpunt |
280.5°C at 760 mmHg |
Brekingsindex |
1.59 |
Vlampunt |
109.4°C |
Dampdruk |
0.00641mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|