5332-96-7 4-Nitrophenylacetone
Naam product |
4-Nitrophenylacetone |
Engelse naam |
4-Nitrophenylacetone; 1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
MF |
C9H9NO3 |
Molecuulgewicht |
179.1727 |
InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
CAS-nummer |
5332-96-7 |
Moleculaire Structuur |
|
Dichtheid |
1.212g/cm3 |
Smeltpunt |
63-64℃ |
Kookpunt |
307.5°C at 760 mmHg |
Brekingsindex |
1.549 |
Vlampunt |
146.4°C |
Dampdruk |
0.000724mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|