ChemNet > CAS > 53350-26-8 3',4',5,5',7-Pentamethoxyflavone
53350-26-8 3',4',5,5',7-Pentamethoxyflavone
Naam product |
3',4',5,5',7-Pentamethoxyflavone |
Engelse naam |
3',4',5,5',7-Pentamethoxyflavone; 3',4',5',5,7-Pentamethoxyflavone; 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
MF |
C20H20O7 |
Molecuulgewicht |
372.3686 |
InChI |
InChI=1/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 |
CAS-nummer |
53350-26-8 |
Moleculaire Structuur |
|
Dichtheid |
1.244g/cm3 |
Kookpunt |
554.4°C at 760 mmHg |
Brekingsindex |
1.565 |
Vlampunt |
243.5°C |
Dampdruk |
2.48E-12mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|