ChemNet > CAS > 5356-71-8 1,3-diphenyl-1H-pyrazol-5-amine
5356-71-8 1,3-diphenyl-1H-pyrazol-5-amine
Naam product |
1,3-diphenyl-1H-pyrazol-5-amine |
Engelse naam |
1,3-diphenyl-1H-pyrazol-5-amine; 5-Amino-1,3-diphenylpyrazole |
MF |
C15H13N3 |
Molecuulgewicht |
235.2838 |
InChI |
InChI=1/C15H13N3/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-11H,16H2 |
CAS-nummer |
5356-71-8 |
Moleculaire Structuur |
|
Dichtheid |
1.17g/cm3 |
Smeltpunt |
129℃ |
Kookpunt |
454°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
228.4°C |
Dampdruk |
1.98E-08mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|