538-58-9;35225-79-7 Dibenzylideneacetone
Naam product |
Dibenzylideneacetone |
Engelse naam |
Dibenzylideneacetone; 1,5-Diphenyl-1,4-pentadien-3-one; distyryl ketone; trans,trans-Dibenzylideneacetone; Dibenzylidene acetone; 1,5-diphenylpenta-1,4-dien-3-one; (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; (1Z,4Z)-1,5-diphenylpenta-1,4-dien-3-one; (1E)-1,5-diphenylpenta-1,4-dien-3-one; 1,5-Diphenyl-3-pentadienone |
MF |
C17H14O |
Molecuulgewicht |
234.2925 |
InChI |
InChI=1/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12u |
CAS-nummer |
538-58-9;35225-79-7 |
EINECS |
208-697-5 |
Moleculaire Structuur |
|
Dichtheid |
1.1g/cm3 |
Smeltpunt |
112-114℃ |
Kookpunt |
400.7°C at 760 mmHg |
Brekingsindex |
1.649 |
Vlampunt |
176.2°C |
Dampdruk |
1.25E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|