ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
| Naam product |
thianaphthene-3-carboxaldehyde |
| Engelse naam |
thianaphthene-3-carboxaldehyde; 1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
| MF |
C9H6OS |
| Molecuulgewicht |
162.2083 |
| InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
| CAS-nummer |
5381-20-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.3g/cm3 |
| Smeltpunt |
56-58℃ |
| Kookpunt |
303.2°C at 760 mmHg |
| Brekingsindex |
1.719 |
| Vlampunt |
137.2°C |
| Dampdruk |
0.000944mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
