5396-71-4 Ethyl 3-nitrocinnamate
Naam product |
Ethyl 3-nitrocinnamate |
Engelse naam |
Ethyl 3-nitrocinnamate; 3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
MF |
C11H11NO4 |
Molecuulgewicht |
221.2093 |
InChI |
InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
CAS-nummer |
5396-71-4 |
EINECS |
226-415-9 |
Moleculaire Structuur |
|
Dichtheid |
1.237g/cm3 |
Smeltpunt |
73-75℃ |
Kookpunt |
346.7°C at 760 mmHg |
Brekingsindex |
1.582 |
Vlampunt |
154.5°C |
Dampdruk |
5.65E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|