541-46-8 isovaleramide
Naam product |
isovaleramide |
Engelse naam |
isovaleramide; Isovaleramide, (3-Methylbutyramide); 3-Methylbutyramide; 3-Methylbutanamide |
MF |
C5H11NO |
Molecuulgewicht |
101.1469 |
InChI |
InChI=1/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
CAS-nummer |
541-46-8 |
EINECS |
208-781-1 |
Moleculaire Structuur |
|
Dichtheid |
0.901g/cm3 |
Kookpunt |
232°C at 760 mmHg |
Brekingsindex |
1.425 |
Vlampunt |
94.1°C |
Dampdruk |
0.0605mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|