ChemNet > CAS > 541-50-4 Acetoacetic Acid
541-50-4 Acetoacetic Acid
| Naam product |
Acetoacetic Acid |
| Engelse naam |
Acetoacetic Acid; 3-Oxobutanoic acid |
| MF |
C4H6O3 |
| Molecuulgewicht |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS-nummer |
541-50-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.182g/cm3 |
| Kookpunt |
237.7°C at 760 mmHg |
| Brekingsindex |
1.427 |
| Vlampunt |
111.8°C |
| Dampdruk |
0.015mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
