ChemNet > CAS > 5432-85-9 4-iso-Propylcyclohexanone
5432-85-9 4-iso-Propylcyclohexanone
| Naam product |
4-iso-Propylcyclohexanone |
| Engelse naam |
4-iso-Propylcyclohexanone; 4-Isopropylcyclohexanone; 4-(propan-2-yl)cyclohexanone |
| MF |
C9H16O |
| Molecuulgewicht |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-7(2)8-3-5-9(10)6-4-8/h7-8H,3-6H2,1-2H3 |
| CAS-nummer |
5432-85-9 |
| EINECS |
226-592-2 |
| Moleculaire Structuur |
|
| Dichtheid |
0.904g/cm3 |
| Kookpunt |
195.6°C at 760 mmHg |
| Brekingsindex |
1.449 |
| Vlampunt |
65°C |
| Dampdruk |
0.416mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
