ChemNet > CAS > 5433-01-2 1-Bromo-3-isopropylbenzene
5433-01-2 1-Bromo-3-isopropylbenzene
Naam product |
1-Bromo-3-isopropylbenzene |
Engelse naam |
1-Bromo-3-isopropylbenzene; 3-Bromocumene; 3-Isopropylbromobenzene; 1-bromo-3-(propan-2-yl)benzene |
MF |
C9H11Br |
Molecuulgewicht |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-7(2)8-4-3-5-9(10)6-8/h3-7H,1-2H3 |
CAS-nummer |
5433-01-2 |
Moleculaire Structuur |
|
Dichtheid |
1.278g/cm3 |
Kookpunt |
210.6°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
81.8°C |
Dampdruk |
0.277mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|