5445-29-4 Ethyl 2-bromooctanoate
Naam product |
Ethyl 2-bromooctanoate |
Engelse naam |
Ethyl 2-bromooctanoate; Ethyl 2-bromocaprylate; 2-Bromooctanoic acid ethyl ester; Octanoic acid, 2-bromoethyl ester; α-Bromo-octanoic acid ethyl ester; Ethyl 2-bromooctanoate, 98+%; Ethyl 2-caprylate; ALPHA-BROMO-OCTANOIC ACID ETHYL ESTER; ethyl (2S)-2-bromooctanoate; ethyl (2R)-2-bromooctanoate |
MF |
C10H19BrO2 |
Molecuulgewicht |
251.1607 |
InChI |
InChI=1/C10H19BrO2/c1-3-5-6-7-8-9(11)10(12)13-4-2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
CAS-nummer |
5445-29-4 |
EINECS |
226-647-0 |
Moleculaire Structuur |
|
Dichtheid |
1.192g/cm3 |
Kookpunt |
243.1°C at 760 mmHg |
Brekingsindex |
1.461 |
Vlampunt |
112.1°C |
Dampdruk |
0.0327mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|