ChemNet > CAS > 5470-95-1 2,3-Dimethoxybenzaldoxime
5470-95-1 2,3-Dimethoxybenzaldoxime
Naam product |
2,3-Dimethoxybenzaldoxime |
Engelse naam |
2,3-Dimethoxybenzaldoxime;o-Veratraldehyde, oxime; 2-08-00-00269 (Beilstein Handbook Reference); AI3-03770; BRN 1953084; Benzaldehyde, 2,3-dimethoxy-, oxime; 1-(2,3-dimethoxyphenyl)-N-hydroxymethanimine; 2,3-dimethoxybenzaldehyde oxime |
MF |
C9H11NO3 |
Molecuulgewicht |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-12-8-5-3-4-7(6-10-11)9(8)13-2/h3-6,11H,1-2H3/b10-6+ |
CAS-nummer |
5470-95-1 |
Moleculaire Structuur |
|
Dichtheid |
1.11g/cm3 |
Kookpunt |
293.1°C at 760 mmHg |
Brekingsindex |
1.501 |
Vlampunt |
131.1°C |
Dampdruk |
0.000802mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|