ChemNet > CAS > 5519-23-3 4-n-Decyloxybenzoic acid
5519-23-3 4-n-Decyloxybenzoic acid
| Naam product |
4-n-Decyloxybenzoic acid |
| Engelse naam |
4-n-Decyloxybenzoic acid; |
| MF |
C17H26O3 |
| Molecuulgewicht |
278.3865 |
| InChI |
InChI=1/C17H26O3/c1-2-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19/h10-13H,2-9,14H2,1H3,(H,18,19) |
| CAS-nummer |
5519-23-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.014g/cm3 |
| Smeltpunt |
94-143℃ |
| Kookpunt |
403.6°C at 760 mmHg |
| Brekingsindex |
1.505 |
| Vlampunt |
138.7°C |
| Dampdruk |
3.07E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
