ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
Naam product |
p-Diethylaminoacetophenone |
Engelse naam |
p-Diethylaminoacetophenone; 4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
MF |
C12H17NO |
Molecuulgewicht |
191.2695 |
InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
CAS-nummer |
5520-66-1 |
Moleculaire Structuur |
|
Dichtheid |
0.996g/cm3 |
Kookpunt |
313.9°C at 760 mmHg |
Brekingsindex |
1.536 |
Vlampunt |
114.4°C |
Dampdruk |
0.000482mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|