ChemNet > CAS > 55259-49-9 Tetramethyltetraselenafulvalene
55259-49-9 Tetramethyltetraselenafulvalene
| Naam product |
Tetramethyltetraselenafulvalene |
| Engelse naam |
Tetramethyltetraselenafulvalene; |
| MF |
C10H12Se4 |
| Molecuulgewicht |
448.0423 |
| InChI |
InChI=1/C10H12Se4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3 |
| CAS-nummer |
55259-49-9 |
| Moleculaire Structuur |
|
| Smeltpunt |
265-270℃ |
| Kookpunt |
338.8°C at 760 mmHg |
| Vlampunt |
158.7°C |
| Dampdruk |
0.000188mmHg at 25°C |
| Gevaarsymbolen |
 T:Toxic;
|
| Risico-codes |
R23/25:Toxic by inhalation and if swallowed.;
R33:Danger of cummulative effects.;
|
| Veiligheid Omschrijving |
S20/21:When using do not eat, drink or smoke.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
