ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
| Naam product |
bis(2-methoxyphenyl) carbonate |
| Engelse naam |
bis(2-methoxyphenyl) carbonate; diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
| MF |
C15H14O5 |
| Molecuulgewicht |
274.2687 |
| InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| CAS-nummer |
553-17-3 |
| EINECS |
209-034-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.208g/cm3 |
| Kookpunt |
392.6°C at 760 mmHg |
| Brekingsindex |
1.552 |
| Vlampunt |
173.7°C |
| Dampdruk |
2.27E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
