5535-52-4 p-Tolyl vinyl sulfoon
Naam product |
p-Tolyl vinyl sulfoon |
Synoniemen |
4-methylfenylvinylsulfon; 1-(ethenylsulfonyl)-4-methylbenzeen; 4-methoxy-N'-[(Z)-(3-fenyl-4H-pyrazol-4-ylideen)methyl]benzohydrazide |
Engelse naam |
p-Tolyl vinyl sulphone; 4-Methylphenyl vinyl sulphone; 1-(ethenylsulfonyl)-4-methylbenzene; 4-methoxy-N'-[(Z)-(3-phenyl-4H-pyrazol-4-ylidene)methyl]benzohydrazide |
MF |
C18H16N4O2 |
Molecuulgewicht |
320.3452 |
InChI |
InChI=1/C18H16N4O2/c1-24-16-9-7-14(8-10-16)18(23)22-20-12-15-11-19-21-17(15)13-5-3-2-4-6-13/h2-12,20H,1H3,(H,22,23)/b15-12- |
CAS-nummer |
5535-52-4 |
Moleculaire Structuur |
|
Dichtheid |
1.23g/cm3 |
Brekingsindex |
1.631 |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|