ChemNet > CAS > 55690-60-3 2-Mercapto-5-methoxybenzothiazole
55690-60-3 2-Mercapto-5-methoxybenzothiazole
Naam product |
2-Mercapto-5-methoxybenzothiazole |
Engelse naam |
2-Mercapto-5-methoxybenzothiazole; 5-Methoxybenzothiazole-2-thiol; 5-methoxy-1,3-benzothiazole-2(3H)-thione; 5-Methoxybenzo[d]thiazole-2-thiol |
MF |
C8H7NOS2 |
Molecuulgewicht |
197.2773 |
InChI |
InChI=1/C8H7NOS2/c1-10-5-2-3-7-6(4-5)9-8(11)12-7/h2-4H,1H3,(H,9,11) |
CAS-nummer |
55690-60-3 |
EINECS |
259-755-1 |
Moleculaire Structuur |
|
Dichtheid |
1.44g/cm3 |
Kookpunt |
340.8°C at 760 mmHg |
Brekingsindex |
1.728 |
Vlampunt |
159.9°C |
Dampdruk |
8.38E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|