ChemNet > CAS > 557-11-9 Allylurea
557-11-9 Allylurea
| Naam product |
Allylurea |
| Engelse naam |
Allylurea;2-Propenylurea; 1-Allylurea; 4-04-00-01070 (Beilstein Handbook Reference); AI3-23204; Allyl urea; Allylcarbamide; BRN 1745068; CCRIS 5958; Monoallylurea; N-2-Propenylurea; N-Allylurea; NSC 7607; Urea, 2-propenyl-; Urea, N-2-propen-1-yl-; Urea, allyl-; 1-prop-2-en-1-ylurea |
| MF |
C4H8N2O |
| Molecuulgewicht |
100.1191 |
| InChI |
InChI=1/C4H8N2O/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| CAS-nummer |
557-11-9 |
| EINECS |
209-157-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.008g/cm3 |
| Smeltpunt |
80-85℃ |
| Kookpunt |
167.9°C at 760 mmHg |
| Brekingsindex |
1.465 |
| Vlampunt |
55.3°C |
| Dampdruk |
1.66mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
