ChemNet > CAS > 55836-71-0 4-ethoxybenzamide
55836-71-0 4-ethoxybenzamide
| Naam product |
4-ethoxybenzamide |
| Engelse naam |
4-ethoxybenzamide; p-Ethoxybenzamide; 4-ethoxy benzamide |
| MF |
C9H11NO2 |
| Molecuulgewicht |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
| CAS-nummer |
55836-71-0 |
| EINECS |
259-847-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.111g/cm3 |
| Smeltpunt |
208-210℃ |
| Kookpunt |
307.7°C at 760 mmHg |
| Brekingsindex |
1.538 |
| Vlampunt |
159°C |
| Dampdruk |
0.000714mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
