ChemNet > CAS > 56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
Naam product |
4,5-Methylenedioxy-2-nitroacetophenone |
Engelse naam |
4,5-Methylenedioxy-2-nitroacetophenone; 1-(6-Nitro-1,3-benzodioxol-5-yl)ethanone; 4',5'-Methylenedioxy-2'-nitroacetophenone |
MF |
C9H7NO5 |
Molecuulgewicht |
209.1556 |
InChI |
InChI=1/C9H7NO5/c1-5(11)6-2-8-9(15-4-14-8)3-7(6)10(12)13/h2-3H,4H2,1H3 |
CAS-nummer |
56136-84-6 |
EINECS |
260-010-8 |
Moleculaire Structuur |
|
Dichtheid |
1.452g/cm3 |
Kookpunt |
392.4°C at 760 mmHg |
Brekingsindex |
1.595 |
Vlampunt |
202.5°C |
Dampdruk |
2.29E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|