ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
| Naam product |
1,5-Dimethyl-2-pyrrolecarbonitrile |
| Engelse naam |
1,5-Dimethyl-2-pyrrolecarbonitrile; 1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
| MF |
C7H8N2 |
| Molecuulgewicht |
120.1518 |
| InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
| CAS-nummer |
56341-36-7 |
| EINECS |
260-120-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.98g/cm3 |
| Smeltpunt |
53-56℃ |
| Kookpunt |
238.9°C at 760 mmHg |
| Brekingsindex |
1.529 |
| Vlampunt |
104.4°C |
| Dampdruk |
0.0414mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
