ChemNet > CAS > 56430-08-1 2,3-dimethyl-1-(4-methylfenyl)-3-pyrazoline-5-on
56430-08-1 2,3-dimethyl-1-(4-methylfenyl)-3-pyrazoline-5-on
| Naam product |
2,3-dimethyl-1-(4-methylfenyl)-3-pyrazoline-5-on |
| Synoniemen |
4-methylfenazon; 1,5-dimethyl-2-(4-methylfenyl)-1,2-dihydro-3H-pyrazol-3-on |
| Engelse naam |
2,3-Dimethyl-1-(4-methylphenyl)-3-pyrazolin-5-one; 4-Methylphenazone; 1,5-dimethyl-2-(4-methylphenyl)-1,2-dihydro-3H-pyrazol-3-one |
| MF |
C12H14N2O |
| Molecuulgewicht |
202.2524 |
| InChI |
InChI=1/C12H14N2O/c1-9-4-6-11(7-5-9)14-12(15)8-10(2)13(14)3/h4-8H,1-3H3 |
| CAS-nummer |
56430-08-1 |
| EINECS |
260-175-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.129g/cm3 |
| Smeltpunt |
134-137℃ |
| Kookpunt |
313.8°C at 760 mmHg |
| Brekingsindex |
1.577 |
| Vlampunt |
131.8°C |
| Dampdruk |
0.000485mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|