ChemNet > CAS > 57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
Naam product |
6-amino-1,3-dihydroisobenzofuran-1-one |
Engelse naam |
6-amino-1,3-dihydroisobenzofuran-1-one; 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
MF |
C8H7NO2 |
Molecuulgewicht |
149.1467 |
InChI |
InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
CAS-nummer |
57319-65-0 |
EINECS |
260-675-4 |
Moleculaire Structuur |
|
Dichtheid |
1.376g/cm3 |
Smeltpunt |
182℃ |
Kookpunt |
420.2°C at 760 mmHg |
Brekingsindex |
1.655 |
Vlampunt |
248.3°C |
Dampdruk |
2.87E-07mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|