ChemNet > CAS > 575-61-1 Benzalphthalide
575-61-1 Benzalphthalide
| Naam product |
Benzalphthalide |
| Engelse naam |
Benzalphthalide; 3-Benzylidenephthalide; Benzalphthalein; (3Z)-3-Benzylidene-2-benzofuran-1(3H)-one; 1(3H)-Isobenzofuranone, 3-(phenylmethylene)-; 3-(phenylmethylene)-1(3h)-isobenzofuranon; 3-benzylidene-phthalid; Benzalphthalid; benzylidenephthalide; escalol547; Phthalide, 3-benzylidene-; (3E)-3-benzylidene-2-benzofuran-1(3H)-one |
| MF |
C15H10O2 |
| Molecuulgewicht |
222.2387 |
| InChI |
InChI=1/C15H10O2/c16-15-13-9-5-4-8-12(13)14(17-15)10-11-6-2-1-3-7-11/h1-10H/b14-10+ |
| CAS-nummer |
575-61-1 |
| EINECS |
209-388-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.278g/cm3 |
| Smeltpunt |
100-104℃ |
| Kookpunt |
374.1°C at 760 mmHg |
| Brekingsindex |
1.686 |
| Vlampunt |
156.9°C |
| Dampdruk |
8.54E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
