ChemNet > CAS > 57598-33-1 2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline
57598-33-1 2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline
Naam product |
2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline |
Engelse naam |
2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline;2-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole; NSC 333420 |
MF |
C12H15NO2 |
Molecuulgewicht |
205.253 |
InChI |
InChI=1/C12H15NO2/c1-12(2)8-15-11(13-12)9-6-4-5-7-10(9)14-3/h4-7H,8H2,1-3H3 |
CAS-nummer |
57598-33-1 |
Moleculaire Structuur |
|
Dichtheid |
1.08g/cm3 |
Smeltpunt |
71-74℃ |
Kookpunt |
311.5°C at 760 mmHg |
Brekingsindex |
1.531 |
Vlampunt |
116.6°C |
Dampdruk |
0.00103mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|