ChemNet > CAS > 579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
| Naam product |
1,2-Diphenyl-1,2-ethanediol (meso) |
| Engelse naam |
1,2-Diphenyl-1,2-ethanediol (meso); meso-Hydrobenzoin; meso-1,2-Diphenyl-1,2-ethanediol; (1R,2S)-1,2-diphenylethane-1,2-diol |
| MF |
C14H14O2 |
| Molecuulgewicht |
214.2598 |
| InChI |
InChI=1/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
| CAS-nummer |
579-43-1 |
| EINECS |
207-758-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.193g/cm3 |
| Smeltpunt |
134-137℃ |
| Kookpunt |
373°C at 760 mmHg |
| Brekingsindex |
1.624 |
| Vlampunt |
179.8°C |
| Dampdruk |
3.18E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
