ChemNet > CAS > 58157-89-4 1-(5-nitro-3-thienyl)ethan-1-on
58157-89-4 1-(5-nitro-3-thienyl)ethan-1-on
| Naam product |
1-(5-nitro-3-thienyl)ethan-1-on |
| Synoniemen |
4-acetyl-2-nitrothiofeen; 1-(5-nitrothiofeen-3-yl)ethanon |
| Engelse naam |
1-(5-nitro-3-thienyl)ethan-1-one; 4-Acetyl-2-nitrothiophene; 1-(5-nitrothiophen-3-yl)ethanone |
| MF |
C6H5NO3S |
| Molecuulgewicht |
171.1738 |
| InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-6(7(9)10)11-3-5/h2-3H,1H3 |
| CAS-nummer |
58157-89-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.399g/cm3 |
| Smeltpunt |
59℃ |
| Kookpunt |
247.9°C at 760 mmHg |
| Brekingsindex |
1.589 |
| Vlampunt |
103.7°C |
| Dampdruk |
0.025mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|