583-03-9 Fenipentol
Naam product |
Fenipentol |
Engelse naam |
Fenipentol; .alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
MF |
C11H16O |
Molecuulgewicht |
164.2441 |
InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
CAS-nummer |
583-03-9 |
EINECS |
209-493-9 |
Moleculaire Structuur |
|
Dichtheid |
0.965g/cm3 |
Kookpunt |
245.2°C at 760 mmHg |
Brekingsindex |
1.514 |
Vlampunt |
110.7°C |
Dampdruk |
0.0156mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|