ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
| Naam product |
4-Methylcyclohexanol, mixture of cis and trans |
| Engelse naam |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
| MF |
C7H14O |
| Molecuulgewicht |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| CAS-nummer |
589-91-3 |
| EINECS |
209-664-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.925g/cm3 |
| Smeltpunt |
-41℃ |
| Kookpunt |
170.322°C at 760 mmHg |
| Brekingsindex |
1.463 |
| Vlampunt |
70°C |
| Oplosbaarheid in water |
slightly soluble |
| Dampdruk |
0.475mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:;
|
|
