ChemNet > CAS > 59463-56-8 cyanomethylethanethioaat
59463-56-8 cyanomethylethanethioaat
| Naam product |
cyanomethylethanethioaat |
| Synoniemen |
S-(cyanomethyl)ethethioaat |
| Engelse naam |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
| MF |
C4H5NOS |
| Molecuulgewicht |
115.1536 |
| InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| CAS-nummer |
59463-56-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.162g/cm3 |
| Kookpunt |
198.1°C at 760 mmHg |
| Brekingsindex |
1.487 |
| Vlampunt |
73.6°C |
| Dampdruk |
0.367mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|