ChemNet > CAS > 5949-05-3 L(-)-Citronellal
5949-05-3 L(-)-Citronellal
| Naam product |
L(-)-Citronellal |
| Synoniemen |
;(S)-(-)-3,7-dimethyl-6-octenaal; (S)-()-Citronellal; Citrnellaal; (-)-Citrnellaal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
| Engelse naam |
L(-)-Citronellal; (S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
| MF |
C10H18O |
| Molecuulgewicht |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
| CAS-nummer |
5949-05-3 |
| EINECS |
227-707-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.835g/cm3 |
| Kookpunt |
208.4°C at 760 mmHg |
| Brekingsindex |
1.437 |
| Vlampunt |
75.6°C |
| Dampdruk |
0.215mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
